C32H29NO7S2 — CID 177149536
4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(2-phenylmethoxyethylsulfonyl)benzenesulfonamide (PubChem CID 177149536) has the molecular formula C32H29NO7S2 and a molecular weight of 603.72 g/mol. Its IUPAC name is 4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(2-phenylmethoxyethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(2-phenylmethoxyethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177149536 |
| Molecular Formula | C32H29NO7S2 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(2-phenylmethoxyethylsulfonyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc3oc(=O)c(-c4ccccc4C)cc3c2)S(=O)(=O)CCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H29NO7S2/c1-23-12-15-28(16-13-23)42(37,38)33(41(35,36)19-18-39-22-25-9-4-3-5-10-25)27-14-17-31-26(20-27)21-30(32(34)40-31)29-11-7-6-8-24(29)2/h3-17,20-21H,18-19,22H2,1-2H3 |
| InChIKey | SOTFPGBSDBWPDA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 110.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|