C28H28N2O8S2 — CID 177149596
methyl 3-[methyl-[[3-(4-methylphenyl)-2-oxochromen-6-yl]-(4-methylphenyl)sulfonylsulfamoyl]amino]propanoate (PubChem CID 177149596) has the molecular formula C28H28N2O8S2 and a molecular weight of 584.67 g/mol. Its IUPAC name is methyl 3-[methyl-[[3-(4-methylphenyl)-2-oxochromen-6-yl]-(4-methylphenyl)sulfonylsulfamoyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[[3-(4-methylphenyl)-2-oxochromen-6-yl]-(4-methylphenyl)sulfonylsulfamoyl]amino]propanoate |
|---|---|
| PubChem CID | 177149596 |
| Molecular Formula | C28H28N2O8S2 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | methyl 3-[methyl-[[3-(4-methylphenyl)-2-oxochromen-6-yl]-(4-methylphenyl)sulfonylsulfamoyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)N(c1ccc2oc(=O)c(-c3ccc(C)cc3)cc2c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H28N2O8S2/c1-19-5-9-21(10-6-19)25-18-22-17-23(11-14-26(22)38-28(25)32)30(39(33,34)24-12-7-20(2)8-13-24)40(35,36)29(3)16-15-27(31)37-4/h5-14,17-18H,15-16H2,1-4H3 |
| InChIKey | IKQHSSHLQAKXRI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|