C35H49NO11 — CID 177154352
1-O-[[acetyl-[2-(7-methoxynaphthalen-1-yl)ethyl]carbamoyl]oxymethyl] 8-O-(1-acetyloxy-3-methoxypropan-2-yl) 3,3,6,6-tetramethyloctanedioate (PubChem CID 177154352) has the molecular formula C35H49NO11 and a molecular weight of 659.77 g/mol. Its IUPAC name is 1-O-[[acetyl-[2-(7-methoxynaphthalen-1-yl)ethyl]carbamoyl]oxymethyl] 8-O-(1-acetyloxy-3-methoxypropan-2-yl) 3,3,6,6-tetramethyloctanedioate.
| Compound Name | 1-O-[[acetyl-[2-(7-methoxynaphthalen-1-yl)ethyl]carbamoyl]oxymethyl] 8-O-(1-acetyloxy-3-methoxypropan-2-yl) 3,3,6,6-tetramethyloctanedioate |
|---|---|
| PubChem CID | 177154352 |
| Molecular Formula | C35H49NO11 |
| Molecular Weight | 659.77 g/mol |
| Exact Mass | 659.33 |
| IUPAC Name | 1-O-[[acetyl-[2-(7-methoxynaphthalen-1-yl)ethyl]carbamoyl]oxymethyl] 8-O-(1-acetyloxy-3-methoxypropan-2-yl) 3,3,6,6-tetramethyloctanedioate |
| SMILES | COCC(COC(C)=O)OC(=O)CC(C)(C)CCC(C)(C)CC(=O)OCOC(=O)N(CCc1cccc2ccc(OC)cc12)C(C)=O |
| InChI | InChI=1S/C35H49NO11/c1-24(37)36(17-14-27-11-9-10-26-12-13-28(43-8)18-30(26)27)33(41)46-23-45-31(39)19-34(3,4)15-16-35(5,6)20-32(40)47-29(21-42-7)22-44-25(2)38/h9-13,18,29H,14-17,19-23H2,1-8H3 |
| InChIKey | XMRMTGIORJONOH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|