C32H41NO12 — CID 177154341
1-O-[[acetyl-[2-[7-(methoxymethyl)naphthalen-1-yl]ethyl]carbamoyl]oxymethyl] 5-O-(1,3-diacetyloxypropan-2-yl) 3,3-dimethylpentanedioate (PubChem CID 177154341) has the molecular formula C32H41NO12 and a molecular weight of 631.68 g/mol. Its IUPAC name is 1-O-[[acetyl-[2-[7-(methoxymethyl)naphthalen-1-yl]ethyl]carbamoyl]oxymethyl] 5-O-(1,3-diacetyloxypropan-2-yl) 3,3-dimethylpentanedioate.
| Compound Name | 1-O-[[acetyl-[2-[7-(methoxymethyl)naphthalen-1-yl]ethyl]carbamoyl]oxymethyl] 5-O-(1,3-diacetyloxypropan-2-yl) 3,3-dimethylpentanedioate |
|---|---|
| PubChem CID | 177154341 |
| Molecular Formula | C32H41NO12 |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | 1-O-[[acetyl-[2-[7-(methoxymethyl)naphthalen-1-yl]ethyl]carbamoyl]oxymethyl] 5-O-(1,3-diacetyloxypropan-2-yl) 3,3-dimethylpentanedioate |
| SMILES | COCc1ccc2cccc(CCN(C(C)=O)C(=O)OCOC(=O)CC(C)(C)CC(=O)OC(COC(C)=O)COC(C)=O)c2c1 |
| InChI | InChI=1S/C32H41NO12/c1-21(34)33(13-12-26-9-7-8-25-11-10-24(17-40-6)14-28(25)26)31(39)44-20-43-29(37)15-32(4,5)16-30(38)45-27(18-41-22(2)35)19-42-23(3)36/h7-11,14,27H,12-13,15-20H2,1-6H3 |
| InChIKey | LHFVBFMDTYUZSG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|