C31H39NO11S — CID 177154328
1-O-[1-[acetyl-[2-(7-methoxynaphthalen-1-yl)ethyl]carbamoyl]oxyethyl] 5-O-(1-acetyloxy-3-ethanethioyloxypropan-2-yl) 3-methylpentanedioate (PubChem CID 177154328) has the molecular formula C31H39NO11S and a molecular weight of 633.72 g/mol. Its IUPAC name is 1-O-[1-[acetyl-[2-(7-methoxynaphthalen-1-yl)ethyl]carbamoyl]oxyethyl] 5-O-(1-acetyloxy-3-ethanethioyloxypropan-2-yl) 3-methylpentanedioate.
| Compound Name | 1-O-[1-[acetyl-[2-(7-methoxynaphthalen-1-yl)ethyl]carbamoyl]oxyethyl] 5-O-(1-acetyloxy-3-ethanethioyloxypropan-2-yl) 3-methylpentanedioate |
|---|---|
| PubChem CID | 177154328 |
| Molecular Formula | C31H39NO11S |
| Molecular Weight | 633.72 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | 1-O-[1-[acetyl-[2-(7-methoxynaphthalen-1-yl)ethyl]carbamoyl]oxyethyl] 5-O-(1-acetyloxy-3-ethanethioyloxypropan-2-yl) 3-methylpentanedioate |
| SMILES | COc1ccc2cccc(CCN(C(C)=O)C(=O)OC(C)OC(=O)CC(C)CC(=O)OC(COC(C)=O)COC(C)=S)c2c1 |
| InChI | InChI=1S/C31H39NO11S/c1-19(15-30(36)43-27(17-39-21(3)34)18-40-23(5)44)14-29(35)41-22(4)42-31(37)32(20(2)33)13-12-25-9-7-8-24-10-11-26(38-6)16-28(24)25/h7-11,16,19,22,27H,12-15,17-18H2,1-6H3 |
| InChIKey | NQPAZMRWTPEYNQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|