C31H41N2O6+ — CID 177234312
[4-[[2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropyl]amino]-2-hydroxy-4-oxobutyl]-trimethylazanium (PubChem CID 177234312) has the molecular formula C31H41N2O6+ and a molecular weight of 537.68 g/mol. Its IUPAC name is [4-[[2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropyl]amino]-2-hydroxy-4-oxobutyl]-trimethylazanium.
| Compound Name | [4-[[2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropyl]amino]-2-hydroxy-4-oxobutyl]-trimethylazanium |
|---|---|
| PubChem CID | 177234312 |
| Molecular Formula | C31H41N2O6+ |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | [4-[[2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropyl]amino]-2-hydroxy-4-oxobutyl]-trimethylazanium |
| SMILES | COc1ccc(C(OC(CO)CNC(=O)CC(O)C[N+](C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H40N2O6/c1-33(2,3)21-26(35)19-30(36)32-20-29(22-34)39-31(23-9-7-6-8-10-23,24-11-15-27(37-4)16-12-24)25-13-17-28(38-5)18-14-25/h6-18,26,29,34-35H,19-22H2,1-5H3/p+1 |
| InChIKey | QMNDXFDXEURNAS-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|