C33H44NO6P — CID 59114106
[2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[[di(propan-2-yl)amino]-methylphosphanyl]oxypropyl] acetate (PubChem CID 59114106) has the molecular formula C33H44NO6P and a molecular weight of 581.69 g/mol. Its IUPAC name is [2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[[di(propan-2-yl)amino]-methylphosphanyl]oxypropyl] acetate.
| Compound Name | [2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[[di(propan-2-yl)amino]-methylphosphanyl]oxypropyl] acetate |
|---|---|
| PubChem CID | 59114106 |
| Molecular Formula | C33H44NO6P |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | [2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[[di(propan-2-yl)amino]-methylphosphanyl]oxypropyl] acetate |
| SMILES | COc1ccc(C(OC(COC(C)=O)COP(C)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H44NO6P/c1-24(2)34(25(3)4)41(8)39-23-32(22-38-26(5)35)40-33(27-12-10-9-11-13-27,28-14-18-30(36-6)19-15-28)29-16-20-31(37-7)21-17-29/h9-21,24-25,32H,22-23H2,1-8H3 |
| InChIKey | YJVKAQIOCUWJMR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|