C29H34N4O5S2 — CID 177286317
(2S)-2-[[(3R)-3-cyclohexyl-2-methyl-7-(methylamino)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine-8-carbonyl]amino]-2-thiophen-3-ylacetic acid (PubChem CID 177286317) has the molecular formula C29H34N4O5S2 and a molecular weight of 582.75 g/mol. Its IUPAC name is (2S)-2-[[(3R)-3-cyclohexyl-2-methyl-7-(methylamino)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine-8-carbonyl]amino]-2-thiophen-3-ylacetic acid.
| Compound Name | (2S)-2-[[(3R)-3-cyclohexyl-2-methyl-7-(methylamino)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine-8-carbonyl]amino]-2-thiophen-3-ylacetic acid |
|---|---|
| PubChem CID | 177286317 |
| Molecular Formula | C29H34N4O5S2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | (2S)-2-[[(3R)-3-cyclohexyl-2-methyl-7-(methylamino)-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine-8-carbonyl]amino]-2-thiophen-3-ylacetic acid |
| SMILES | CNc1cc2c(cc1C(=O)N[C@H](C(=O)O)c1ccsc1)S(=O)(=O)N(C)[C@H](C1CCCCC1)CN2c1ccccc1 |
| InChI | InChI=1S/C29H34N4O5S2/c1-30-23-16-24-26(15-22(23)28(34)31-27(29(35)36)20-13-14-39-18-20)40(37,38)32(2)25(19-9-5-3-6-10-19)17-33(24)21-11-7-4-8-12-21/h4,7-8,11-16,18-19,25,27,30H,3,5-6,9-10,17H2,1-2H3,(H,31,34)(H,35,36)/t25-,27-/m0/s1 |
| InChIKey | JJKLPAFXMSMFAP-BDYUSTAISA-N |
| XLogP | 5.07 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |