C47H87NO6 — CID 177314962
[2-[3-(dimethylamino)propyl]-5-[[(Z)-octadec-9-enoyl]oxymethyl]-1,3-dioxan-5-yl]methyl (Z)-octadec-9-enoate (PubChem CID 177314962) has the molecular formula C47H87NO6 and a molecular weight of 762.21 g/mol. Its IUPAC name is [2-[3-(dimethylamino)propyl]-5-[[(Z)-octadec-9-enoyl]oxymethyl]-1,3-dioxan-5-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [2-[3-(dimethylamino)propyl]-5-[[(Z)-octadec-9-enoyl]oxymethyl]-1,3-dioxan-5-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 177314962 |
| Molecular Formula | C47H87NO6 |
| Molecular Weight | 762.21 g/mol |
| Exact Mass | 761.65 |
| IUPAC Name | [2-[3-(dimethylamino)propyl]-5-[[(Z)-octadec-9-enoyl]oxymethyl]-1,3-dioxan-5-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC1(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC(CCCN(C)C)OC1 |
| InChI | InChI=1S/C47H87NO6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-44(49)51-40-47(42-53-46(54-43-47)38-35-39-48(3)4)41-52-45(50)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,46H,5-18,23-43H2,1-4H3/b21-19-,22-20- |
| InChIKey | VVLREEVUXGTKKI-WRBBJXAJSA-N |
| XLogP | 12.85 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.21 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|