C29H25N2O3P2+ — CID 177385802
1-benzyl-5-diphenylphosphoryl-6-methyl-2-oxo-3-phenyl-1,3,2-diazaphosphinin-2-ium-4-one (PubChem CID 177385802) has the molecular formula C29H25N2O3P2+ and a molecular weight of 511.48 g/mol. Its IUPAC name is 1-benzyl-5-diphenylphosphoryl-6-methyl-2-oxo-3-phenyl-1,3,2-diazaphosphinin-2-ium-4-one.
| Compound Name | 1-benzyl-5-diphenylphosphoryl-6-methyl-2-oxo-3-phenyl-1,3,2-diazaphosphinin-2-ium-4-one |
|---|---|
| PubChem CID | 177385802 |
| Molecular Formula | C29H25N2O3P2+ |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 1-benzyl-5-diphenylphosphoryl-6-methyl-2-oxo-3-phenyl-1,3,2-diazaphosphinin-2-ium-4-one |
| SMILES | Cc1c(P(=O)(c2ccccc2)c2ccccc2)c(=O)n(-c2ccccc2)[p+](=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C29H25N2O3P2/c1-23-28(36(34,26-18-10-4-11-19-26)27-20-12-5-13-21-27)29(32)31(25-16-8-3-9-17-25)35(33)30(23)22-24-14-6-2-7-15-24/h2-21H,22H2,1H3/q+1 |
| InChIKey | MBTIPXQWUFTVAT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|