About CID 177450399
CID 177450399 (PubChem CID 177450399) has the molecular formula C9H11Br
and a molecular weight of 199.09 g/mol.
Molecular Properties
| Compound Name | CID 177450399 |
| PubChem CID | 177450399 |
| Molecular Formula | C9H11Br |
| Molecular Weight | 199.09 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | — |
| SMILES | Br[C]C12CC3C1CCCC32 |
| InChI | InChI=1S/C9H11Br/c10-5-9-4-6-7(9)2-1-3-8(6)9/h6-8H,1-4H2 |
| InChIKey | AAWAAZHWDBYJMQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 177450399 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177450399?
The IUPAC name of CID 177450399 (CID 177450399) is not available.
What is the SMILES notation for CID 177450399?
The canonical SMILES for CID 177450399 is Br[C]C12CC3C1CCCC32.
What is the InChIKey of CID 177450399?
The InChIKey is AAWAAZHWDBYJMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Br/c10-5-9-4-6-7(9)2-1-3-8(6)9/h6-8H,1-4H2.
What are the key properties of CID 177450399?
CID 177450399 has a molecular weight of 199.09 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177450399 is sourced from PubChem (CID 177450399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).