About 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane
1-(dibromomethyl)tricyclo[4.2.0.02,7]octane (PubChem CID 177469763) has the molecular formula C9H12Br2
and a molecular weight of 280.00 g/mol. Its IUPAC name is 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane.
Molecular Properties
| Compound Name | 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane |
| PubChem CID | 177469763 |
| Molecular Formula | C9H12Br2 |
| Molecular Weight | 280.00 g/mol |
| Exact Mass | 277.93 |
| IUPAC Name | 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane |
| SMILES | BrC(Br)C12CC3C1CCCC32 |
| InChI | InChI=1S/C9H12Br2/c10-8(11)9-4-5-6(9)2-1-3-7(5)9/h5-8H,1-4H2 |
| InChIKey | WAWLJROEWUYIQY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.00 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane?
The IUPAC name of 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane (CID 177469763) is 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane.
What is the SMILES notation for 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane?
The canonical SMILES for 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane is BrC(Br)C12CC3C1CCCC32.
What is the InChIKey of 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane?
The InChIKey is WAWLJROEWUYIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Br2/c10-8(11)9-4-5-6(9)2-1-3-7(5)9/h5-8H,1-4H2.
What are the key properties of 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane?
1-(dibromomethyl)tricyclo[4.2.0.02,7]octane has a molecular weight of 280.00 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dibromomethyl)tricyclo[4.2.0.02,7]octane is sourced from PubChem (CID 177469763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).