C21H27N2O5PS — CID 177496212
N-[(E)-(2-diethoxyphosphoryl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-4-methylbenzenesulfonamide (PubChem CID 177496212) has the molecular formula C21H27N2O5PS and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[(E)-(2-diethoxyphosphoryl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-(2-diethoxyphosphoryl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177496212 |
| Molecular Formula | C21H27N2O5PS |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[(E)-(2-diethoxyphosphoryl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-4-methylbenzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C1CCc2ccccc2/C1=N\NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27N2O5PS/c1-4-27-29(24,28-5-2)20-15-12-17-8-6-7-9-19(17)21(20)22-23-30(25,26)18-13-10-16(3)11-14-18/h6-11,13-14,20,23H,4-5,12,15H2,1-3H3/b22-21+ |
| InChIKey | XOWUHUBKRCQLLV-QURGRASLSA-N |
| XLogP | 4.26 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|