C18H20Cl2N4 — CID 178014475
(1Z,3E)-1,4-dichloro-2-N-[(Z)-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienylidene]amino]-2-N-methylbuta-1,3-diene-1,2,4-triamine (PubChem CID 178014475) has the molecular formula C18H20Cl2N4 and a molecular weight of 363.29 g/mol. Its IUPAC name is (1Z,3E)-1,4-dichloro-2-N-[(Z)-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienylidene]amino]-2-N-methylbuta-1,3-diene-1,2,4-triamine.
| Compound Name | (1Z,3E)-1,4-dichloro-2-N-[(Z)-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienylidene]amino]-2-N-methylbuta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 178014475 |
| Molecular Formula | C18H20Cl2N4 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (1Z,3E)-1,4-dichloro-2-N-[(Z)-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienylidene]amino]-2-N-methylbuta-1,3-diene-1,2,4-triamine |
| SMILES | C=C/C=C(C=C)/C(=N/N(C)C(/C=C(\N)Cl)=C(/N)Cl)c1ccccc1 |
| InChI | InChI=1S/C18H20Cl2N4/c1-4-9-13(5-2)17(14-10-7-6-8-11-14)23-24(3)15(18(20)22)12-16(19)21/h4-12H,1-2,21-22H2,3H3/b13-9+,16-12-,18-15+,23-17- |
| InChIKey | YNRFAHKUXAOJLT-BWKHYGHGSA-N |
| XLogP | 4.03 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|