C23H23F4NO2 — CID 178040796
7-(4-fluorophenoxy)-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-1,3-benzoxazole (PubChem CID 178040796) has the molecular formula C23H23F4NO2 and a molecular weight of 421.43 g/mol. Its IUPAC name is 7-(4-fluorophenoxy)-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-1,3-benzoxazole.
| Compound Name | 7-(4-fluorophenoxy)-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 178040796 |
| Molecular Formula | C23H23F4NO2 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 7-(4-fluorophenoxy)-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-1,3-benzoxazole |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1nc2c(o1)C(Oc1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C23H23F4NO2/c1-3-6-15(14-16(7-4-2)23(25,26)27)22-28-19-8-5-9-20(21(19)30-22)29-18-12-10-17(24)11-13-18/h3,6-7,10-14,20H,4-5,8-9H2,1-2H3/b6-3-,15-14+,16-7- |
| InChIKey | WQPRRIBSJVMYSP-ZZAMVELSSA-N |
| XLogP | 7.13 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|