C34H46N10O6 — CID 178057779
tert-butyl 3-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxycarbonylphenyl]methyl]piperidin-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate (PubChem CID 178057779) has the molecular formula C34H46N10O6 and a molecular weight of 690.81 g/mol. Its IUPAC name is tert-butyl 3-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxycarbonylphenyl]methyl]piperidin-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 3-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxycarbonylphenyl]methyl]piperidin-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 178057779 |
| Molecular Formula | C34H46N10O6 |
| Molecular Weight | 690.81 g/mol |
| Exact Mass | 690.36 |
| IUPAC Name | tert-butyl 3-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxycarbonylphenyl]methyl]piperidin-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(c5nnc6n5CCN(C(=O)OC(C)(C)C)C6)CC4)cc3C(=O)OC)c2n1 |
| InChI | InChI=1S/C34H46N10O6/c1-6-7-16-49-31-37-27(35)26-29(38-31)44(32(46)36-26)19-23-9-8-21(17-24(23)30(45)48-5)18-41-12-10-22(11-13-41)28-40-39-25-20-42(14-15-43(25)28)33(47)50-34(2,3)4/h8-9,17,22H,6-7,10-16,18-20H2,1-5H3,(H,36,46)(H2,35,37,38) |
| InChIKey | OUNUFPHTOFXXAY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 188.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|