C29H38N10O4 — CID 178057860
methyl 2-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]benzoate (PubChem CID 178057860) has the molecular formula C29H38N10O4 and a molecular weight of 590.69 g/mol. Its IUPAC name is methyl 2-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 178057860 |
| Molecular Formula | C29H38N10O4 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | methyl 2-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]benzoate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(c5nnc6n5CCNC6)CC4)cc3C(=O)OC)c2n1 |
| InChI | InChI=1S/C29H38N10O4/c1-3-4-13-43-28-33-24(30)23-26(34-28)39(29(41)32-23)17-20-6-5-18(14-21(20)27(40)42-2)16-37-10-7-19(8-11-37)25-36-35-22-15-31-9-12-38(22)25/h5-6,14,19,31H,3-4,7-13,15-17H2,1-2H3,(H,32,41)(H2,30,33,34) |
| InChIKey | UYJGCLJSAWINOT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 171.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|