C36H42N4O8 — CID 178094541
4-N,4-N-dimethyl-2-pentoxybenzene-1,4-diamine;(4-nitrophenyl) 4-(4-aminobenzoyl)oxy-2-propoxybenzoate (PubChem CID 178094541) has the molecular formula C36H42N4O8 and a molecular weight of 658.75 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-pentoxybenzene-1,4-diamine;(4-nitrophenyl) 4-(4-aminobenzoyl)oxy-2-propoxybenzoate.
| Compound Name | 4-N,4-N-dimethyl-2-pentoxybenzene-1,4-diamine;(4-nitrophenyl) 4-(4-aminobenzoyl)oxy-2-propoxybenzoate |
|---|---|
| PubChem CID | 178094541 |
| Molecular Formula | C36H42N4O8 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | 4-N,4-N-dimethyl-2-pentoxybenzene-1,4-diamine;(4-nitrophenyl) 4-(4-aminobenzoyl)oxy-2-propoxybenzoate |
| SMILES | CCCCCOc1cc(N(C)C)ccc1N.CCCOc1cc(OC(=O)c2ccc(N)cc2)ccc1C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H20N2O7.C13H22N2O/c1-2-13-30-21-14-19(32-22(26)15-3-5-16(24)6-4-15)11-12-20(21)23(27)31-18-9-7-17(8-10-18)25(28)29;1-4-5-6-9-16-13-10-11(15(2)3)7-8-12(13)14/h3-12,14H,2,13,24H2,1H3;7-8,10H,4-6,9,14H2,1-3H3 |
| InChIKey | RVZLJCWHQCSNLH-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 169.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|