C31H48N6O3S — CID 178105416
CID 178105416 (PubChem CID 178105416) has the molecular formula C31H48N6O3S and a molecular weight of 584.83 g/mol.
| Compound Name | CID 178105416 |
|---|---|
| PubChem CID | 178105416 |
| Molecular Formula | C31H48N6O3S |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | — |
| SMILES | CC.CCC[C@@H]([C@H](C)n1nc(C)c2c(SC)nc(-c3noc4c3CCC[C@@]43CCCCC34OCCO4)nc21)N(C)C |
| InChI | InChI=1S/C29H42N6O3S.C2H6/c1-7-11-21(34(4)5)19(3)35-26-22(18(2)32-35)27(39-6)31-25(30-26)23-20-12-10-14-28(24(20)38-33-23)13-8-9-15-29(28)36-16-17-37-29;1-2/h19,21H,7-17H2,1-6H3;1-2H3/t19-,21-,28-;/m0./s1 |
| InChIKey | DSDUKXDRZXWSRB-HUQDUCBISA-N |
| XLogP | 6.72 |
| TPSA | 91.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |