C13H4BrF5NO3- — CID 178149288
2-bromo-5-methyl-6-(2,3,4,5,6-pentafluorophenoxy)carbonylpyridin-3-olate (PubChem CID 178149288) has the molecular formula C13H4BrF5NO3- and a molecular weight of 397.07 g/mol. Its IUPAC name is 2-bromo-5-methyl-6-(2,3,4,5,6-pentafluorophenoxy)carbonylpyridin-3-olate.
| Compound Name | 2-bromo-5-methyl-6-(2,3,4,5,6-pentafluorophenoxy)carbonylpyridin-3-olate |
|---|---|
| PubChem CID | 178149288 |
| Molecular Formula | C13H4BrF5NO3- |
| Molecular Weight | 397.07 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 2-bromo-5-methyl-6-(2,3,4,5,6-pentafluorophenoxy)carbonylpyridin-3-olate |
| SMILES | Cc1cc([O-])c(Br)nc1C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H5BrF5NO3/c1-3-2-4(21)12(14)20-10(3)13(22)23-11-8(18)6(16)5(15)7(17)9(11)19/h2,21H,1H3/p-1 |
| InChIKey | IBJOLCWQMDBCJS-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.07 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|