C16H23N3O2 — CID 178166255
cyclohexa-1,5-dien-1-ylmethyl N-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]cyclobutyl]carbamate (PubChem CID 178166255) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]cyclobutyl]carbamate.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl N-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 178166255 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl N-[3-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]cyclobutyl]carbamate |
| SMILES | C/N=C/C(=C\N)C1CC(NC(=O)OCC2=CCCC=C2)C1 |
| InChI | InChI=1S/C16H23N3O2/c1-18-10-14(9-17)13-7-15(8-13)19-16(20)21-11-12-5-3-2-4-6-12/h3,5-6,9-10,13,15H,2,4,7-8,11,17H2,1H3,(H,19,20)/b14-9+,18-10+ |
| InChIKey | GEACIEGJHPEAKD-FCJXZZIYSA-N |
| XLogP | 2.31 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|