C18H15N3O7 — CID 18100417
methyl 2,4-dimethyl-5-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]-1H-pyrrole-3-carboxylate (PubChem CID 18100417) has the molecular formula C18H15N3O7 and a molecular weight of 385.33 g/mol. Its IUPAC name is methyl 2,4-dimethyl-5-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 2,4-dimethyl-5-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 18100417 |
| Molecular Formula | C18H15N3O7 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | methyl 2,4-dimethyl-5-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c1C |
| InChI | InChI=1S/C18H15N3O7/c1-8-13(18(25)28-3)9(2)19-15(8)12(22)7-20-16(23)10-5-4-6-11(21(26)27)14(10)17(20)24/h4-6,19H,7H2,1-3H3 |
| InChIKey | IZJRPEXPYNWRSS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|