C20H13NO2S2 — CID 18271193
(4-phenylphenyl) 2-thiophen-3-yl-1,3-thiazole-4-carboxylate (PubChem CID 18271193) has the molecular formula C20H13NO2S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (4-phenylphenyl) 2-thiophen-3-yl-1,3-thiazole-4-carboxylate.
| Compound Name | (4-phenylphenyl) 2-thiophen-3-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 18271193 |
| Molecular Formula | C20H13NO2S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | (4-phenylphenyl) 2-thiophen-3-yl-1,3-thiazole-4-carboxylate |
| SMILES | O=C(Oc1ccc(-c2ccccc2)cc1)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C20H13NO2S2/c22-20(18-13-25-19(21-18)16-10-11-24-12-16)23-17-8-6-15(7-9-17)14-4-2-1-3-5-14/h1-13H |
| InChIKey | HKILDCVRCXXJSN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|