C17H13ClF4O4 — CID 18346503
4-[(4-ethoxy-2,3,5,6-tetrafluorophenyl)methoxy]-3-methoxybenzoyl chloride (PubChem CID 18346503) has the molecular formula C17H13ClF4O4 and a molecular weight of 392.73 g/mol. Its IUPAC name is 4-[(4-ethoxy-2,3,5,6-tetrafluorophenyl)methoxy]-3-methoxybenzoyl chloride.
| Compound Name | 4-[(4-ethoxy-2,3,5,6-tetrafluorophenyl)methoxy]-3-methoxybenzoyl chloride |
|---|---|
| PubChem CID | 18346503 |
| Molecular Formula | C17H13ClF4O4 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 4-[(4-ethoxy-2,3,5,6-tetrafluorophenyl)methoxy]-3-methoxybenzoyl chloride |
| SMILES | CCOc1c(F)c(F)c(COc2ccc(C(=O)Cl)cc2OC)c(F)c1F |
| InChI | InChI=1S/C17H13ClF4O4/c1-3-25-16-14(21)12(19)9(13(20)15(16)22)7-26-10-5-4-8(17(18)23)6-11(10)24-2/h4-6H,3,7H2,1-2H3 |
| InChIKey | WQSWJJIERVVHMW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|