C23H24O6S — CID 18421092
(9,10-dimethoxy-4-oxo-2,3,5,6-tetrahydro-1H-benzo[e]azulen-8-yl) 4-methylbenzenesulfonate (PubChem CID 18421092) has the molecular formula C23H24O6S and a molecular weight of 428.51 g/mol. Its IUPAC name is (9,10-dimethoxy-4-oxo-2,3,5,6-tetrahydro-1H-benzo[e]azulen-8-yl) 4-methylbenzenesulfonate.
| Compound Name | (9,10-dimethoxy-4-oxo-2,3,5,6-tetrahydro-1H-benzo[e]azulen-8-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 18421092 |
| Molecular Formula | C23H24O6S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (9,10-dimethoxy-4-oxo-2,3,5,6-tetrahydro-1H-benzo[e]azulen-8-yl) 4-methylbenzenesulfonate |
| SMILES | COc1c(OS(=O)(=O)c2ccc(C)cc2)cc2c(c1OC)C1=C(CCC1)C(=O)CC2 |
| InChI | InChI=1S/C23H24O6S/c1-14-7-10-16(11-8-14)30(25,26)29-20-13-15-9-12-19(24)17-5-4-6-18(17)21(15)23(28-3)22(20)27-2/h7-8,10-11,13H,4-6,9,12H2,1-3H3 |
| InChIKey | BKGHAJNELJHHML-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|