C23H22O5S — CID 91553235
(9,10-dimethoxy-5,6-dihydrobenzo[e]azulen-8-yl) 4-methylbenzenesulfonate (PubChem CID 91553235) has the molecular formula C23H22O5S and a molecular weight of 410.49 g/mol. Its IUPAC name is (9,10-dimethoxy-5,6-dihydrobenzo[e]azulen-8-yl) 4-methylbenzenesulfonate.
| Compound Name | (9,10-dimethoxy-5,6-dihydrobenzo[e]azulen-8-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91553235 |
| Molecular Formula | C23H22O5S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (9,10-dimethoxy-5,6-dihydrobenzo[e]azulen-8-yl) 4-methylbenzenesulfonate |
| SMILES | COc1c(OS(=O)(=O)c2ccc(C)cc2)cc2c(c1OC)C1=CC=CC1=CCC2 |
| InChI | InChI=1S/C23H22O5S/c1-15-10-12-18(13-11-15)29(24,25)28-20-14-17-8-4-6-16-7-5-9-19(16)21(17)23(27-3)22(20)26-2/h5-7,9-14H,4,8H2,1-3H3 |
| InChIKey | XWHLZONRQCGAEE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|