About 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol
4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol (PubChem CID 18433187) has the molecular formula C30H52OS
and a molecular weight of 460.81 g/mol. Its IUPAC name is 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol.
Molecular Properties
| Compound Name | 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol |
| PubChem CID | 18433187 |
| Molecular Formula | C30H52OS |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol |
| SMILES | CCCCCCCC1(CCCCCCC)Cc2c(cc(C(C)(C)C)c(O)c2C(C)(C)C)S1 |
| InChI | InChI=1S/C30H52OS/c1-9-11-13-15-17-19-30(20-18-16-14-12-10-2)22-23-25(32-30)21-24(28(3,4)5)27(31)26(23)29(6,7)8/h21,31H,9-20,22H2,1-8H3 |
| InChIKey | DPIYHGWDMOIUOO-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol?
The IUPAC name of 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol (CID 18433187) is 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol.
What is the SMILES notation for 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol?
The canonical SMILES for 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol is CCCCCCCC1(CCCCCCC)Cc2c(cc(C(C)(C)C)c(O)c2C(C)(C)C)S1.
What is the InChIKey of 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol?
The InChIKey is DPIYHGWDMOIUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H52OS/c1-9-11-13-15-17-19-30(20-18-16-14-12-10-2)22-23-25(32-30)21-24(28(3,4)5)27(31)26(23)29(6,7)8/h21,31H,9-20,22H2,1-8H3.
What are the key properties of 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol?
4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol has a molecular weight of 460.81 g/mol, XLogP of 10.10, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-ditert-butyl-2,2-diheptyl-3H-1-benzothiophen-5-ol is sourced from PubChem (CID 18433187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).