C35H62O2 — CID 150426308
5,7-ditert-butyl-2,2-di(nonyl)-3,4-dihydrochromen-6-ol (PubChem CID 150426308) has the molecular formula C35H62O2 and a molecular weight of 514.88 g/mol. Its IUPAC name is 5,7-ditert-butyl-2,2-di(nonyl)-3,4-dihydrochromen-6-ol.
| Compound Name | 5,7-ditert-butyl-2,2-di(nonyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 150426308 |
| Molecular Formula | C35H62O2 |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 514.47 |
| IUPAC Name | 5,7-ditert-butyl-2,2-di(nonyl)-3,4-dihydrochromen-6-ol |
| SMILES | CCCCCCCCCC1(CCCCCCCCC)CCc2c(cc(C(C)(C)C)c(O)c2C(C)(C)C)O1 |
| InChI | InChI=1S/C35H62O2/c1-9-11-13-15-17-19-21-24-35(25-22-20-18-16-14-12-10-2)26-23-28-30(37-35)27-29(33(3,4)5)32(36)31(28)34(6,7)8/h27,36H,9-26H2,1-8H3 |
| InChIKey | HIVGBBYOCYDCPL-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|