C17H25ClO2 — CID 18433164
4,6-ditert-butyl-2-(chloromethyl)-2,3-dihydro-1-benzofuran-5-ol (PubChem CID 18433164) has the molecular formula C17H25ClO2 and a molecular weight of 296.84 g/mol. Its IUPAC name is 4,6-ditert-butyl-2-(chloromethyl)-2,3-dihydro-1-benzofuran-5-ol.
| Compound Name | 4,6-ditert-butyl-2-(chloromethyl)-2,3-dihydro-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 18433164 |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4,6-ditert-butyl-2-(chloromethyl)-2,3-dihydro-1-benzofuran-5-ol |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1O)CC(CCl)O2 |
| InChI | InChI=1S/C17H25ClO2/c1-16(2,3)12-8-13-11(7-10(9-18)20-13)14(15(12)19)17(4,5)6/h8,10,19H,7,9H2,1-6H3 |
| InChIKey | KIOFIVGWTJETAV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|