C22H36O4S — CID 18598397
4-[2-[(1R,2R,3S,4S)-3-[(E)-4,4-dimethyl-3-oxooct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]butanoic acid (PubChem CID 18598397) has the molecular formula C22H36O4S and a molecular weight of 396.59 g/mol. Its IUPAC name is 4-[2-[(1R,2R,3S,4S)-3-[(E)-4,4-dimethyl-3-oxooct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(1R,2R,3S,4S)-3-[(E)-4,4-dimethyl-3-oxooct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 18598397 |
| Molecular Formula | C22H36O4S |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4-[2-[(1R,2R,3S,4S)-3-[(E)-4,4-dimethyl-3-oxooct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]butanoic acid |
| SMILES | CCCCC(C)(C)C(=O)/C=C/[C@H]1[C@@H](CCSCCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H36O4S/c1-4-5-13-22(2,3)20(23)11-8-16-17(19-10-9-18(16)26-19)12-15-27-14-6-7-21(24)25/h8,11,16-19H,4-7,9-10,12-15H2,1-3H3,(H,24,25)/b11-8+/t16-,17+,18-,19+/m0/s1 |
| InChIKey | PPCOLFRMIGITAV-VTKYHGCRSA-N |
| XLogP | 5.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|