C23H28N4O7 — CID 18610693
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[3-(4-methoxyphenyl)-3-oxopropanoyl]benzoic acid (PubChem CID 18610693) has the molecular formula C23H28N4O7 and a molecular weight of 472.50 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[3-(4-methoxyphenyl)-3-oxopropanoyl]benzoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[3-(4-methoxyphenyl)-3-oxopropanoyl]benzoic acid |
|---|---|
| PubChem CID | 18610693 |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[3-(4-methoxyphenyl)-3-oxopropanoyl]benzoic acid |
| SMILES | COc1ccc(C(=O)CC(=O)c2ccccc2C(=O)O)cc1.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C17H14O5.C6H14N4O2/c1-22-12-8-6-11(7-9-12)15(18)10-16(19)13-4-2-3-5-14(13)17(20)21;7-4(5(11)12)2-1-3-10-6(8)9/h2-9H,10H2,1H3,(H,20,21);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | BXHZPQMOZNSZQM-VWMHFEHESA-N |
| XLogP | 1.30 |
| TPSA | 208.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|