C22H22F3NO7 — CID 18620442
[3-(2-acetyloxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexene-1-carbonyl)-6-(trifluoromethyl)-2-pyridinyl]methyl acetate (PubChem CID 18620442) has the molecular formula C22H22F3NO7 and a molecular weight of 469.41 g/mol. Its IUPAC name is [3-(2-acetyloxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexene-1-carbonyl)-6-(trifluoromethyl)-2-pyridinyl]methyl acetate.
| Compound Name | [3-(2-acetyloxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexene-1-carbonyl)-6-(trifluoromethyl)-2-pyridinyl]methyl acetate |
|---|---|
| PubChem CID | 18620442 |
| Molecular Formula | C22H22F3NO7 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [3-(2-acetyloxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexene-1-carbonyl)-6-(trifluoromethyl)-2-pyridinyl]methyl acetate |
| SMILES | CC(=O)OCc1nc(C(F)(F)F)ccc1C(=O)C1=C(OC(C)=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C22H22F3NO7/c1-10(27)32-9-13-12(7-8-14(26-13)22(23,24)25)16(29)15-17(30)20(3,4)19(31)21(5,6)18(15)33-11(2)28/h7-8H,9H2,1-6H3 |
| InChIKey | PKIQBUPGFSZDBE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 116.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|