C29H58O2Si2 — CID 18636636
tert-butyl-dimethyl-[(3S)-3-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]octan-3-yl]oxysilane (PubChem CID 18636636) has the molecular formula C29H58O2Si2 and a molecular weight of 494.95 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S)-3-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]octan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S)-3-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]octan-3-yl]oxysilane |
|---|---|
| PubChem CID | 18636636 |
| Molecular Formula | C29H58O2Si2 |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.40 |
| IUPAC Name | tert-butyl-dimethyl-[(3S)-3-methyl-1-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]octan-3-yl]oxysilane |
| SMILES | C=CC[C@@H]1C(CC[C@](C)(CCCCC)O[Si](C)(C)C(C)(C)C)=CC[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H58O2Si2/c1-12-17-18-23-29(9,31-32(10,11)28(6,7)8)24-22-25-20-21-27(26(25)19-13-2)30-33(14-3,15-4)16-5/h13,20,26-27H,2,12,14-19,21-24H2,1,3-11H3/t26-,27+,29+/m1/s1 |
| InChIKey | OLQRDWOYLRPMPE-XQFUHLNNSA-N |
| XLogP | 10.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|