C46H86O6 — CID 18637519
(9R,10S,11S,12R)-9,12-bis(dec-1-en-4-yl)-7,14-bis(prop-2-enyl)icosane-8,9,10,11,12,13-hexol (PubChem CID 18637519) has the molecular formula C46H86O6 and a molecular weight of 735.19 g/mol. Its IUPAC name is (9R,10S,11S,12R)-9,12-bis(dec-1-en-4-yl)-7,14-bis(prop-2-enyl)icosane-8,9,10,11,12,13-hexol.
| Compound Name | (9R,10S,11S,12R)-9,12-bis(dec-1-en-4-yl)-7,14-bis(prop-2-enyl)icosane-8,9,10,11,12,13-hexol |
|---|---|
| PubChem CID | 18637519 |
| Molecular Formula | C46H86O6 |
| Molecular Weight | 735.19 g/mol |
| Exact Mass | 734.64 |
| IUPAC Name | (9R,10S,11S,12R)-9,12-bis(dec-1-en-4-yl)-7,14-bis(prop-2-enyl)icosane-8,9,10,11,12,13-hexol |
| SMILES | C=CCC(CCCCCC)C(O)[C@](O)(C(CC=C)CCCCCC)[C@@H](O)[C@H](O)[C@@](O)(C(CC=C)CCCCCC)C(O)C(CC=C)CCCCCC |
| InChI | InChI=1S/C46H86O6/c1-9-17-21-25-33-37(29-13-5)41(47)45(51,39(31-15-7)35-27-23-19-11-3)43(49)44(50)46(52,40(32-16-8)36-28-24-20-12-4)42(48)38(30-14-6)34-26-22-18-10-2/h13-16,37-44,47-52H,5-12,17-36H2,1-4H3/t37?,38?,39?,40?,41?,42?,43-,44-,45+,46+/m0/s1 |
| InChIKey | JIBOMJBTDJTRNM-CGVJCVOISA-N |
| XLogP | 10.54 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.19 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|