C45H33N5O9 — CID 18639238
[2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-2,3-dibenzoyl-3,4-dihydroxyoxolan-2-yl]-1,3-dioxo-1,3-diphenylpropan-2-yl] benzoate (PubChem CID 18639238) has the molecular formula C45H33N5O9 and a molecular weight of 787.79 g/mol. Its IUPAC name is [2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-2,3-dibenzoyl-3,4-dihydroxyoxolan-2-yl]-1,3-dioxo-1,3-diphenylpropan-2-yl] benzoate.
| Compound Name | [2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-2,3-dibenzoyl-3,4-dihydroxyoxolan-2-yl]-1,3-dioxo-1,3-diphenylpropan-2-yl] benzoate |
|---|---|
| PubChem CID | 18639238 |
| Molecular Formula | C45H33N5O9 |
| Molecular Weight | 787.79 g/mol |
| Exact Mass | 787.23 |
| IUPAC Name | [2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-2,3-dibenzoyl-3,4-dihydroxyoxolan-2-yl]-1,3-dioxo-1,3-diphenylpropan-2-yl] benzoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@](C(=O)c2ccccc2)(C(OC(=O)c2ccccc2)(C(=O)c2ccccc2)C(=O)c2ccccc2)[C@](O)(C(=O)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C45H33N5O9/c46-39-33-40(48-26-47-39)50(27-49-33)41-38(55)43(57,34(51)28-16-6-1-7-17-28)45(58-41,37(54)31-22-12-4-13-23-31)44(35(52)29-18-8-2-9-19-29,36(53)30-20-10-3-11-21-30)59-42(56)32-24-14-5-15-25-32/h1-27,38,41,55,57H,(H2,46,47,48)/t38-,41+,43-,45-/m0/s1 |
| InChIKey | ZCMCTZXTEJHREE-ZAAQHRCJSA-N |
| XLogP | 4.90 |
| TPSA | 213.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|