C36H38O7Si — CID 18661193
[(2S,3R,4R,5R)-4-benzoyl-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-3,4-dihydroxy-5-methoxyoxolan-3-yl]-phenylmethanone (PubChem CID 18661193) has the molecular formula C36H38O7Si and a molecular weight of 610.78 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-4-benzoyl-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-3,4-dihydroxy-5-methoxyoxolan-3-yl]-phenylmethanone.
| Compound Name | [(2S,3R,4R,5R)-4-benzoyl-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-3,4-dihydroxy-5-methoxyoxolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 18661193 |
| Molecular Formula | C36H38O7Si |
| Molecular Weight | 610.78 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | [(2S,3R,4R,5R)-4-benzoyl-2-[[tert-butyl(diphenyl)silyl]-hydroxymethyl]-3,4-dihydroxy-5-methoxyoxolan-3-yl]-phenylmethanone |
| SMILES | CO[C@@H]1O[C@H](C(O)[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@](O)(C(=O)c2ccccc2)[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C36H38O7Si/c1-34(2,3)44(27-21-13-7-14-22-27,28-23-15-8-16-24-28)32(39)31-35(40,29(37)25-17-9-5-10-18-25)36(41,33(42-4)43-31)30(38)26-19-11-6-12-20-26/h5-24,31-33,39-41H,1-4H3/t31-,32?,33-,35-,36+/m1/s1 |
| InChIKey | DWORTJMGCVYPHF-CNUHRDLISA-N |
| XLogP | 3.55 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.78 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|