C39H49N4O6S+ — CID 18714472
[9-[2-(2,6-dibutyl-1,1,3,5-tetraoxo-1,2,6-thiadiazinane-4-carbonyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 18714472) has the molecular formula C39H49N4O6S+ and a molecular weight of 701.91 g/mol. Its IUPAC name is [9-[2-(2,6-dibutyl-1,1,3,5-tetraoxo-1,2,6-thiadiazinane-4-carbonyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[2-(2,6-dibutyl-1,1,3,5-tetraoxo-1,2,6-thiadiazinane-4-carbonyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 18714472 |
| Molecular Formula | C39H49N4O6S+ |
| Molecular Weight | 701.91 g/mol |
| Exact Mass | 701.34 |
| IUPAC Name | [9-[2-(2,6-dibutyl-1,1,3,5-tetraoxo-1,2,6-thiadiazinane-4-carbonyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCCCN1C(=O)C(C(=O)c2ccccc2-c2c3ccc(=[N+](CC)CC)cc-3oc3cc(N(CC)CC)ccc23)C(=O)N(CCCC)S1(=O)=O |
| InChI | InChI=1S/C39H49N4O6S/c1-7-13-23-42-38(45)36(39(46)43(24-14-8-2)50(42,47)48)37(44)30-18-16-15-17-29(30)35-31-21-19-27(40(9-3)10-4)25-33(31)49-34-26-28(20-22-32(34)35)41(11-5)12-6/h15-22,25-26,36H,7-14,23-24H2,1-6H3/q+1 |
| InChIKey | YZLRKWKROKDZOF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.91 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|