C16H21NO3 — CID 18889437
1'-butyl-7'-methylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 18889437) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1'-butyl-7'-methylspiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-butyl-7'-methylspiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18889437 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1'-butyl-7'-methylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCCCN1C(=O)C2(OCCCO2)c2cccc(C)c21 |
| InChI | InChI=1S/C16H21NO3/c1-3-4-9-17-14-12(2)7-5-8-13(14)16(15(17)18)19-10-6-11-20-16/h5,7-8H,3-4,6,9-11H2,1-2H3 |
| InChIKey | MYIXIHLIMLYJOL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |