C13H15NO2 — CID 18963990
2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-cyclopenta[b]indol-7-ol (PubChem CID 18963990) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-cyclopenta[b]indol-7-ol.
| Compound Name | 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-cyclopenta[b]indol-7-ol |
|---|---|
| PubChem CID | 18963990 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-cyclopenta[b]indol-7-ol |
| SMILES | Cn1c2c(c3cc(O)ccc31)CC(CO)C2 |
| InChI | InChI=1S/C13H15NO2/c1-14-12-3-2-9(16)6-11(12)10-4-8(7-15)5-13(10)14/h2-3,6,8,15-16H,4-5,7H2,1H3 |
| InChIKey | ADGDJAGBDVENRA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|