C7H11F7OSi — CID 18970464
1,2,2,3,3,4,4-heptafluorobutoxy(trimethyl)silane (PubChem CID 18970464) has the molecular formula C7H11F7OSi and a molecular weight of 272.24 g/mol. Its IUPAC name is 1,2,2,3,3,4,4-heptafluorobutoxy(trimethyl)silane.
| Compound Name | 1,2,2,3,3,4,4-heptafluorobutoxy(trimethyl)silane |
|---|---|
| PubChem CID | 18970464 |
| Molecular Formula | C7H11F7OSi |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1,2,2,3,3,4,4-heptafluorobutoxy(trimethyl)silane |
| SMILES | C[Si](C)(C)OC(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H11F7OSi/c1-16(2,3)15-5(10)7(13,14)6(11,12)4(8)9/h4-5H,1-3H3 |
| InChIKey | JWOMWJVFQUAQHM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|