C23H26F3NO — CID 19022856
1-benzyl-4-[1-[3-(trifluoromethyl)phenyl]prop-2-enoxymethyl]piperidine (PubChem CID 19022856) has the molecular formula C23H26F3NO and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-benzyl-4-[1-[3-(trifluoromethyl)phenyl]prop-2-enoxymethyl]piperidine.
| Compound Name | 1-benzyl-4-[1-[3-(trifluoromethyl)phenyl]prop-2-enoxymethyl]piperidine |
|---|---|
| PubChem CID | 19022856 |
| Molecular Formula | C23H26F3NO |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-benzyl-4-[1-[3-(trifluoromethyl)phenyl]prop-2-enoxymethyl]piperidine |
| SMILES | C=CC(OCC1CCN(Cc2ccccc2)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H26F3NO/c1-2-22(20-9-6-10-21(15-20)23(24,25)26)28-17-19-11-13-27(14-12-19)16-18-7-4-3-5-8-18/h2-10,15,19,22H,1,11-14,16-17H2 |
| InChIKey | TWVJIBVJJMYEOW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|