C24H42N10O4 — CID 19034506
3-[[4-[4-[4,6-bis(3-hydroxypropylamino)-1,3,5-triazin-2-yl]cyclohexyl]-6-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]amino]propan-1-ol (PubChem CID 19034506) has the molecular formula C24H42N10O4 and a molecular weight of 534.67 g/mol. Its IUPAC name is 3-[[4-[4-[4,6-bis(3-hydroxypropylamino)-1,3,5-triazin-2-yl]cyclohexyl]-6-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4-[4-[4,6-bis(3-hydroxypropylamino)-1,3,5-triazin-2-yl]cyclohexyl]-6-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 19034506 |
| Molecular Formula | C24H42N10O4 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | 3-[[4-[4-[4,6-bis(3-hydroxypropylamino)-1,3,5-triazin-2-yl]cyclohexyl]-6-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nc(NCCCO)nc(C2CCC(c3nc(NCCCO)nc(NCCCO)n3)CC2)n1 |
| InChI | InChI=1S/C24H42N10O4/c35-13-1-9-25-21-29-19(30-22(33-21)26-10-2-14-36)17-5-7-18(8-6-17)20-31-23(27-11-3-15-37)34-24(32-20)28-12-4-16-38/h17-18,35-38H,1-16H2,(H2,25,26,29,30,33)(H2,27,28,31,32,34) |
| InChIKey | KEQIUBPJOGIUNT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 206.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|