C20H28O — CID 19077120
2-(5,5,8,8-tetramethyl-1,2,3,4,6,7-hexahydroanthracen-1-yl)acetaldehyde (PubChem CID 19077120) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-(5,5,8,8-tetramethyl-1,2,3,4,6,7-hexahydroanthracen-1-yl)acetaldehyde.
| Compound Name | 2-(5,5,8,8-tetramethyl-1,2,3,4,6,7-hexahydroanthracen-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 19077120 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-(5,5,8,8-tetramethyl-1,2,3,4,6,7-hexahydroanthracen-1-yl)acetaldehyde |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCCC3CC=O |
| InChI | InChI=1S/C20H28O/c1-19(2)9-10-20(3,4)18-13-16-14(8-11-21)6-5-7-15(16)12-17(18)19/h11-14H,5-10H2,1-4H3 |
| InChIKey | VSTYHQAJFUJRDG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|