C14H17ClF3NO2 — CID 19097080
1,1,1-trifluorooctan-2-yl 2-chloropyridine-3-carboxylate (PubChem CID 19097080) has the molecular formula C14H17ClF3NO2 and a molecular weight of 323.74 g/mol. Its IUPAC name is 1,1,1-trifluorooctan-2-yl 2-chloropyridine-3-carboxylate.
| Compound Name | 1,1,1-trifluorooctan-2-yl 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 19097080 |
| Molecular Formula | C14H17ClF3NO2 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1,1,1-trifluorooctan-2-yl 2-chloropyridine-3-carboxylate |
| SMILES | CCCCCCC(OC(=O)c1cccnc1Cl)C(F)(F)F |
| InChI | InChI=1S/C14H17ClF3NO2/c1-2-3-4-5-8-11(14(16,17)18)21-13(20)10-7-6-9-19-12(10)15/h6-7,9,11H,2-5,8H2,1H3 |
| InChIKey | NNXJSVDRVUEBFD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|