C12H14N2O — CID 19597591
2-(1-methylpyrrolidin-2-yl)furo[2,3-b]pyridine (PubChem CID 19597591) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-2-yl)furo[2,3-b]pyridine.
| Compound Name | 2-(1-methylpyrrolidin-2-yl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 19597591 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-(1-methylpyrrolidin-2-yl)furo[2,3-b]pyridine |
| SMILES | CN1CCCC1c1cc2cccnc2o1 |
| InChI | InChI=1S/C12H14N2O/c1-14-7-3-5-10(14)11-8-9-4-2-6-13-12(9)15-11/h2,4,6,8,10H,3,5,7H2,1H3 |
| InChIKey | FEVBLIMLWKRQRY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |