C35H32ClNO3S — CID 19600521
[2-(3-chlorophenyl)-3-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-6-yl] benzoate (PubChem CID 19600521) has the molecular formula C35H32ClNO3S and a molecular weight of 582.17 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-3-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-6-yl] benzoate.
| Compound Name | [2-(3-chlorophenyl)-3-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-6-yl] benzoate |
|---|---|
| PubChem CID | 19600521 |
| Molecular Formula | C35H32ClNO3S |
| Molecular Weight | 582.17 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | [2-(3-chlorophenyl)-3-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-6-yl] benzoate |
| SMILES | O=C(Oc1ccc2c(Cc3ccc(OCCN4CCCCC4)cc3)c(-c3cccc(Cl)c3)sc2c1)c1ccccc1 |
| InChI | InChI=1S/C35H32ClNO3S/c36-28-11-7-10-27(23-28)34-32(22-25-12-14-29(15-13-25)39-21-20-37-18-5-2-6-19-37)31-17-16-30(24-33(31)41-34)40-35(38)26-8-3-1-4-9-26/h1,3-4,7-17,23-24H,2,5-6,18-22H2 |
| InChIKey | RUYZXDFFSBYVAT-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.17 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|