C25H25N5O2S3 — CID 19723592
2-[[2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19723592) has the molecular formula C25H25N5O2S3 and a molecular weight of 523.71 g/mol. Its IUPAC name is 2-[[2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19723592 |
| Molecular Formula | C25H25N5O2S3 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 2-[[2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(N)=O)CCC(C)C3)nnc1-c1csc2ccccc12 |
| InChI | InChI=1S/C25H25N5O2S3/c1-3-10-30-23(17-12-33-18-7-5-4-6-15(17)18)28-29-25(30)34-13-20(31)27-24-21(22(26)32)16-9-8-14(2)11-19(16)35-24/h3-7,12,14H,1,8-11,13H2,2H3,(H2,26,32)(H,27,31) |
| InChIKey | BZNFNNZLVGVOEG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|