C11Cl2F20I4 — CID 19900919
2,4-dichloro-1,1,2,3,3,4,5,5-octafluoro-1,5-diiodopentane;1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane (PubChem CID 19900919) has the molecular formula C11Cl2F20I4 and a molecular weight of 1090.60 g/mol. Its IUPAC name is 2,4-dichloro-1,1,2,3,3,4,5,5-octafluoro-1,5-diiodopentane;1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane.
| Compound Name | 2,4-dichloro-1,1,2,3,3,4,5,5-octafluoro-1,5-diiodopentane;1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane |
|---|---|
| PubChem CID | 19900919 |
| Molecular Formula | C11Cl2F20I4 |
| Molecular Weight | 1090.60 g/mol |
| Exact Mass | 1089.52 |
| IUPAC Name | 2,4-dichloro-1,1,2,3,3,4,5,5-octafluoro-1,5-diiodopentane;1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane |
| SMILES | FC(F)(I)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)I.FC(F)(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C6F12I2.C5Cl2F8I2/c7-1(8,3(11,12)5(15,16)19)2(9,10)4(13,14)6(17,18)20;6-1(8,4(12,13)16)3(10,11)2(7,9)5(14,15)17 |
| InChIKey | KDFZFRMEHQTYFT-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.60 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|