About (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene
(5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene (PubChem CID 20589185) has the molecular formula C15H18N2O4S
and a molecular weight of 322.39 g/mol. Its IUPAC name is (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene.
Molecular Properties
| Compound Name | (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene |
| PubChem CID | 20589185 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene |
| SMILES | CCc1ccc(OC)c(/N=N/c2ccc(S(O)(O)O)cc2)c1 |
| InChI | InChI=1S/C15H18N2O4S/c1-3-11-4-9-15(21-2)14(10-11)17-16-12-5-7-13(8-6-12)22(18,19)20/h4-10,18-20H,3H2,1-2H3/b17-16+ |
| InChIKey | KUCSMCPFBMTQBC-WUKNDPDISA-N |
| XLogP | 5.26 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene?
The IUPAC name of (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene (CID 20589185) is (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene.
What is the SMILES notation for (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene?
The canonical SMILES for (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene is CCc1ccc(OC)c(/N=N/c2ccc(S(O)(O)O)cc2)c1.
What is the InChIKey of (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene?
The InChIKey is KUCSMCPFBMTQBC-WUKNDPDISA-N. The full InChI is InChI=1S/C15H18N2O4S/c1-3-11-4-9-15(21-2)14(10-11)17-16-12-5-7-13(8-6-12)22(18,19)20/h4-10,18-20H,3H2,1-2H3/b17-16+.
What are the key properties of (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene?
(5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene has a molecular weight of 322.39 g/mol, XLogP of 5.26, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2-methoxyphenyl)-[4-(trihydroxy-λ4-sulfanyl)phenyl]diazene is sourced from PubChem (CID 20589185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).