C21H28N2 — CID 2060893
1,3-bis(2,4,6-trimethylphenyl)imidazolidine (PubChem CID 2060893) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidine.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
|---|---|
| PubChem CID | 2060893 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2)c(C)c1 |
| InChI | InChI=1S/C21H28N2/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6/h9-12H,7-8,13H2,1-6H3 |
| InChIKey | RUKVGXGTVPPWDD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |